C9H5F11O2 — CID 14007673
ethyl (E)-2,3,5,5,5-pentafluoro-4,4-bis(trifluoromethyl)pent-2-enoate (PubChem CID 14007673) has the molecular formula C9H5F11O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is ethyl (E)-2,3,5,5,5-pentafluoro-4,4-bis(trifluoromethyl)pent-2-enoate.
| Compound Name | ethyl (E)-2,3,5,5,5-pentafluoro-4,4-bis(trifluoromethyl)pent-2-enoate |
|---|---|
| PubChem CID | 14007673 |
| Molecular Formula | C9H5F11O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | ethyl (E)-2,3,5,5,5-pentafluoro-4,4-bis(trifluoromethyl)pent-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F11O2/c1-2-22-5(21)3(10)4(11)6(7(12,13)14,8(15,16)17)9(18,19)20/h2H2,1H3/b4-3+ |
| InChIKey | YGCMCEAUQVQEFL-ONEGZZNKSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|