C34H42N2O6P2 — CID 14026708
N,N'-bis[bis(2,6-dimethylphenoxy)phosphoryl]ethane-1,2-diamine (PubChem CID 14026708) has the molecular formula C34H42N2O6P2 and a molecular weight of 636.67 g/mol. Its IUPAC name is N,N'-bis[bis(2,6-dimethylphenoxy)phosphoryl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[bis(2,6-dimethylphenoxy)phosphoryl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14026708 |
| Molecular Formula | C34H42N2O6P2 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | N,N'-bis[bis(2,6-dimethylphenoxy)phosphoryl]ethane-1,2-diamine |
| SMILES | Cc1cccc(C)c1OP(=O)(NCCNP(=O)(Oc1c(C)cccc1C)Oc1c(C)cccc1C)Oc1c(C)cccc1C |
| InChI | InChI=1S/C34H42N2O6P2/c1-23-13-9-14-24(2)31(23)39-43(37,40-32-25(3)15-10-16-26(32)4)35-21-22-36-44(38,41-33-27(5)17-11-18-28(33)6)42-34-29(7)19-12-20-30(34)8/h9-20H,21-22H2,1-8H3,(H,35,37)(H,36,38) |
| InChIKey | RXHIQTLPSVHHGI-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|