C21H22BrN2O3+ — CID 1403369
(5S)-5-(5-bromo-1H-indol-3-yl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 1403369) has the molecular formula C21H22BrN2O3+ and a molecular weight of 430.32 g/mol. Its IUPAC name is (5S)-5-(5-bromo-1H-indol-3-yl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | (5S)-5-(5-bromo-1H-indol-3-yl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 1403369 |
| Molecular Formula | C21H22BrN2O3+ |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (5S)-5-(5-bromo-1H-indol-3-yl)-4-methoxy-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | COc1c2c(cc3c1[C@H](c1c[nH]c4ccc(Br)cc14)[N+](C)(C)CC3)OCO2 |
| InChI | InChI=1S/C21H22BrN2O3/c1-24(2)7-6-12-8-17-20(27-11-26-17)21(25-3)18(12)19(24)15-10-23-16-5-4-13(22)9-14(15)16/h4-5,8-10,19,23H,6-7,11H2,1-3H3/q+1/t19-/m0/s1 |
| InChIKey | NIDMHAHZQCAPSS-IBGZPJMESA-N |
| XLogP | 4.39 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|