C27H41Br3O — CID 14034460
(2R,6R,8S,9S,10R,13R,14S,17R)-2,4,6-tribromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 14034460) has the molecular formula C27H41Br3O and a molecular weight of 621.34 g/mol. Its IUPAC name is (2R,6R,8S,9S,10R,13R,14S,17R)-2,4,6-tribromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (2R,6R,8S,9S,10R,13R,14S,17R)-2,4,6-tribromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 14034460 |
| Molecular Formula | C27H41Br3O |
| Molecular Weight | 621.34 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | (2R,6R,8S,9S,10R,13R,14S,17R)-2,4,6-tribromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](Br)C4=C(Br)C(=O)[C@H](Br)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H41Br3O/c1-15(2)7-6-8-16(3)18-9-10-19-17-13-21(28)23-24(30)25(31)22(29)14-27(23,5)20(17)11-12-26(18,19)4/h15-22H,6-14H2,1-5H3/t16-,17+,18-,19+,20+,21-,22-,26-,27-/m1/s1 |
| InChIKey | BWRSPJHBOVUNND-BJYUHMDZSA-N |
| XLogP | 9.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.34 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|