C9H15NO2S2 — CID 14036261
methyl 6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate (PubChem CID 14036261) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is methyl 6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | methyl 6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 14036261 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)C1CC2(CN1)SCCCS2 |
| InChI | InChI=1S/C9H15NO2S2/c1-12-8(11)7-5-9(6-10-7)13-3-2-4-14-9/h7,10H,2-6H2,1H3 |
| InChIKey | MRYQJKWTWPKFNB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |