C18H18O6 — CID 14039098
(9,10-dihydroxy-8-methoxy-4-oxo-2,3-dihydro-1H-anthracen-2-yl)methyl acetate (PubChem CID 14039098) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (9,10-dihydroxy-8-methoxy-4-oxo-2,3-dihydro-1H-anthracen-2-yl)methyl acetate.
| Compound Name | (9,10-dihydroxy-8-methoxy-4-oxo-2,3-dihydro-1H-anthracen-2-yl)methyl acetate |
|---|---|
| PubChem CID | 14039098 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (9,10-dihydroxy-8-methoxy-4-oxo-2,3-dihydro-1H-anthracen-2-yl)methyl acetate |
| SMILES | COc1cccc2c(O)c3c(c(O)c12)CC(COC(C)=O)CC3=O |
| InChI | InChI=1S/C18H18O6/c1-9(19)24-8-10-6-12-15(13(20)7-10)17(21)11-4-3-5-14(23-2)16(11)18(12)22/h3-5,10,21-22H,6-8H2,1-2H3 |
| InChIKey | IYPGPLGWBATBEK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|