C20H22O7 — CID 163114187
1-(2,9,10-trihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl)ethyl acetate (PubChem CID 163114187) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-(2,9,10-trihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl)ethyl acetate.
| Compound Name | 1-(2,9,10-trihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl)ethyl acetate |
|---|---|
| PubChem CID | 163114187 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-(2,9,10-trihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl)ethyl acetate |
| SMILES | COc1cccc2c(O)c3c(c(O)c12)C(=O)CC(C)(O)C3C(C)OC(C)=O |
| InChI | InChI=1S/C20H22O7/c1-9(27-10(2)21)17-16-15(12(22)8-20(17,3)25)19(24)14-11(18(16)23)6-5-7-13(14)26-4/h5-7,9,17,23-25H,8H2,1-4H3 |
| InChIKey | UWKGMILNJMBASL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|