C20H20O7 — CID 163191416
(Z)-3-[(1S,2S)-2,10-dihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl]-3-methoxyprop-2-enoic acid (PubChem CID 163191416) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is (Z)-3-[(1S,2S)-2,10-dihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl]-3-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[(1S,2S)-2,10-dihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 163191416 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (Z)-3-[(1S,2S)-2,10-dihydroxy-5-methoxy-2-methyl-4-oxo-1,3-dihydroanthracen-1-yl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C\C(=O)O)[C@H]1c2cc3cccc(OC)c3c(O)c2C(=O)C[C@]1(C)O |
| InChI | InChI=1S/C20H20O7/c1-20(25)9-12(21)17-11(18(20)14(27-3)8-15(22)23)7-10-5-4-6-13(26-2)16(10)19(17)24/h4-8,18,24-25H,9H2,1-3H3,(H,22,23)/b14-8-/t18-,20+/m1/s1 |
| InChIKey | XLWNJIRNWLVIGU-YVBICIIGSA-N |
| XLogP | 2.59 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|