C4H6Br2O2S — CID 1403915
(2R,3S)-2,3-dibromothiolane 1,1-dioxide (PubChem CID 1403915) has the molecular formula C4H6Br2O2S and a molecular weight of 277.97 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromothiolane 1,1-dioxide.
| Compound Name | (2R,3S)-2,3-dibromothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 1403915 |
| Molecular Formula | C4H6Br2O2S |
| Molecular Weight | 277.97 g/mol |
| Exact Mass | 275.85 |
| IUPAC Name | (2R,3S)-2,3-dibromothiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H](Br)[C@H]1Br |
| InChI | InChI=1S/C4H6Br2O2S/c5-3-1-2-9(7,8)4(3)6/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | IWPCGTXDZACYSU-IMJSIDKUSA-N |
| XLogP | 1.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.97 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|