C17H18N3+ — CID 14041634
2,4-diphenyl-1-propan-2-yltriazol-1-ium (PubChem CID 14041634) has the molecular formula C17H18N3+ and a molecular weight of 264.35 g/mol. Its IUPAC name is 2,4-diphenyl-1-propan-2-yltriazol-1-ium.
| Compound Name | 2,4-diphenyl-1-propan-2-yltriazol-1-ium |
|---|---|
| PubChem CID | 14041634 |
| Molecular Formula | C17H18N3+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2,4-diphenyl-1-propan-2-yltriazol-1-ium |
| SMILES | CC(C)[n+]1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H18N3/c1-14(2)19-13-17(15-9-5-3-6-10-15)18-20(19)16-11-7-4-8-12-16/h3-14H,1-2H3/q+1 |
| InChIKey | PJEVKJPVZHLVOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|