C12H8ClF3N2O2 — CID 14049736
2-chloro-N-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 14049736) has the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.66 g/mol. Its IUPAC name is 2-chloro-N-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 14049736 |
| Molecular Formula | C12H8ClF3N2O2 |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-chloro-N-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | O=C(CCl)Nc1onc(C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C12H8ClF3N2O2/c13-6-8(19)17-11-9(7-4-2-1-3-5-7)10(18-20-11)12(14,15)16/h1-5H,6H2,(H,17,19) |
| InChIKey | AHPSFBKFHMSMPV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|