C12H27NO3 — CID 140506267
4-amino-4-(1-hydroxypropyl)-5-methyloctane-3,6-diol (PubChem CID 140506267) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-amino-4-(1-hydroxypropyl)-5-methyloctane-3,6-diol.
| Compound Name | 4-amino-4-(1-hydroxypropyl)-5-methyloctane-3,6-diol |
|---|---|
| PubChem CID | 140506267 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 4-amino-4-(1-hydroxypropyl)-5-methyloctane-3,6-diol |
| SMILES | CCC(O)C(C)C(N)(C(O)CC)C(O)CC |
| InChI | InChI=1S/C12H27NO3/c1-5-9(14)8(4)12(13,10(15)6-2)11(16)7-3/h8-11,14-16H,5-7,13H2,1-4H3 |
| InChIKey | CTZZBRLLXAIMIN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |