C11H25NO3 — CID 140506269
4-amino-4-(1-hydroxypropyl)octane-3,6-diol (PubChem CID 140506269) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is 4-amino-4-(1-hydroxypropyl)octane-3,6-diol.
| Compound Name | 4-amino-4-(1-hydroxypropyl)octane-3,6-diol |
|---|---|
| PubChem CID | 140506269 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 4-amino-4-(1-hydroxypropyl)octane-3,6-diol |
| SMILES | CCC(O)CC(N)(C(O)CC)C(O)CC |
| InChI | InChI=1S/C11H25NO3/c1-4-8(13)7-11(12,9(14)5-2)10(15)6-3/h8-10,13-15H,4-7,12H2,1-3H3 |
| InChIKey | WHJFALKWLKHNHX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |