C11H9NO4 — CID 140510528
hydroxymethyl 1-oxo-2H-isoquinoline-3-carboxylate (PubChem CID 140510528) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is hydroxymethyl 1-oxo-2H-isoquinoline-3-carboxylate.
| Compound Name | hydroxymethyl 1-oxo-2H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 140510528 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | hydroxymethyl 1-oxo-2H-isoquinoline-3-carboxylate |
| SMILES | O=C(OCO)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9NO4/c13-6-16-11(15)9-5-7-3-1-2-4-8(7)10(14)12-9/h1-5,13H,6H2,(H,12,14) |
| InChIKey | XPLXRGVEXMLLHE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|