C16H18N2O4 — CID 91647362
[2-(tert-butylamino)-2-oxoethyl] 1-oxo-2H-isoquinoline-3-carboxylate (PubChem CID 91647362) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 1-oxo-2H-isoquinoline-3-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 1-oxo-2H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91647362 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 1-oxo-2H-isoquinoline-3-carboxylate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N2O4/c1-16(2,3)18-13(19)9-22-15(21)12-8-10-6-4-5-7-11(10)14(20)17-12/h4-8H,9H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | GEZHGXWJGRHJLK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |