C17H17N3O3 — CID 7466136
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7466136) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7466136 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)c1cc2ccccc2[nH]1)C1CC1 |
| InChI | InChI=1S/C17H17N3O3/c1-17(10-18,12-6-7-12)20-15(21)9-23-16(22)14-8-11-4-2-3-5-13(11)19-14/h2-5,8,12,19H,6-7,9H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | JTZYNPXYMFGYPE-QGZVFWFLSA-N |
| XLogP | 2.13 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |