C13H14BrN3O3 — CID 18203717
[2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 18203717) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is [2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18203717 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | [2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | CC(C#N)(NC(=O)COC(=O)c1cc(Br)c[nH]1)C1CC1 |
| InChI | InChI=1S/C13H14BrN3O3/c1-13(7-15,8-2-3-8)17-11(18)6-20-12(19)10-4-9(14)5-16-10/h4-5,8,16H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | OQZPVDASFSJNGT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |