C15H8BrFN4 — CID 140511768
2-(4-bromoanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile (PubChem CID 140511768) has the molecular formula C15H8BrFN4 and a molecular weight of 343.16 g/mol. Its IUPAC name is 2-(4-bromoanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 2-(4-bromoanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140511768 |
| Molecular Formula | C15H8BrFN4 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-(4-bromoanilino)-6-fluoro-1,7-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cc2cc(F)ncc2nc1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H8BrFN4/c16-11-1-3-12(4-2-11)20-15-10(7-18)5-9-6-14(17)19-8-13(9)21-15/h1-6,8H,(H,20,21) |
| InChIKey | SJCORSTZKPOMJI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|