C15H22N2 — CID 140514520
1-N-cyclohexyl-4-N-propan-2-ylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 140514520) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-N-propan-2-ylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N-cyclohexyl-4-N-propan-2-ylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 140514520 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-N-cyclohexyl-4-N-propan-2-ylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CC(C)N=C1C=CC(=NC2CCCCC2)C=C1 |
| InChI | InChI=1S/C15H22N2/c1-12(2)16-14-8-10-15(11-9-14)17-13-6-4-3-5-7-13/h8-13H,3-7H2,1-2H3/b16-14-,17-15+ |
| InChIKey | NAMMNKUNTWARSY-QUDUTFMFSA-N |
| XLogP | 3.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|