C12H16N2 — CID 57006458
1,2,3,4,4a,6,9,9a-octahydrophenazine (PubChem CID 57006458) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,2,3,4,4a,6,9,9a-octahydrophenazine.
| Compound Name | 1,2,3,4,4a,6,9,9a-octahydrophenazine |
|---|---|
| PubChem CID | 57006458 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1,2,3,4,4a,6,9,9a-octahydrophenazine |
| SMILES | C1=CCC2N=C3CCCCC3N=C2C1 |
| InChI | InChI=1S/C12H16N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-2,9,12H,3-8H2 |
| InChIKey | HVKUNLNZVTXROA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|