C29H20F7NO — CID 140515174
N-[2-fluoro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 140515174) has the molecular formula C29H20F7NO and a molecular weight of 531.47 g/mol. Its IUPAC name is N-[2-fluoro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | N-[2-fluoro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 140515174 |
| Molecular Formula | C29H20F7NO |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N-[2-fluoro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C(F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H20F7NO/c30-25(19-9-3-1-4-10-19)27(37-26(38)20-11-5-2-6-12-20,21-13-7-15-23(17-21)28(31,32)33)22-14-8-16-24(18-22)29(34,35)36/h1-18,25H,(H,37,38) |
| InChIKey | BAUMCPVYARFTKL-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |