C27H18F6N2O4 — CID 140515165
N-[2-nitro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide (PubChem CID 140515165) has the molecular formula C27H18F6N2O4 and a molecular weight of 548.44 g/mol. Its IUPAC name is N-[2-nitro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-nitro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 140515165 |
| Molecular Formula | C27H18F6N2O4 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | N-[2-nitro-2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C(c1ccccc1)[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C27H18F6N2O4/c28-26(29,30)20-11-4-9-18(15-20)25(34-24(36)22-13-6-14-39-22,19-10-5-12-21(16-19)27(31,32)33)23(35(37)38)17-7-2-1-3-8-17/h1-16,23H,(H,34,36) |
| InChIKey | QHPVMKAAPGJUQO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|