C22H30O5 — CID 140517333
[1-benzyl-3-hydroxy-2-[(Z)-1-hydroxyoct-1-enyl]-5-oxocyclopentyl] acetate (PubChem CID 140517333) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [1-benzyl-3-hydroxy-2-[(Z)-1-hydroxyoct-1-enyl]-5-oxocyclopentyl] acetate.
| Compound Name | [1-benzyl-3-hydroxy-2-[(Z)-1-hydroxyoct-1-enyl]-5-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 140517333 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [1-benzyl-3-hydroxy-2-[(Z)-1-hydroxyoct-1-enyl]-5-oxocyclopentyl] acetate |
| SMILES | CCCCCC/C=C(\O)C1C(O)CC(=O)C1(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C22H30O5/c1-3-4-5-6-10-13-18(24)21-19(25)14-20(26)22(21,27-16(2)23)15-17-11-8-7-9-12-17/h7-9,11-13,19,21,24-25H,3-6,10,14-15H2,1-2H3/b18-13- |
| InChIKey | IIXANUUXOGGIRQ-AQTBWJFISA-N |
| XLogP | 3.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|