C26H31NO3 — CID 140519813
(8R,9S,13S,14S,17S)-13-methyl-2-[(E)-phenylmethoxyiminomethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 140519813) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methyl-2-[(E)-phenylmethoxyiminomethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-13-methyl-2-[(E)-phenylmethoxyiminomethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 140519813 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-2-[(E)-phenylmethoxyiminomethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4cc(/C=N/OCc5ccccc5)c(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C26H31NO3/c1-26-12-11-20-21(23(26)9-10-25(26)29)8-7-18-14-24(28)19(13-22(18)20)15-27-30-16-17-5-3-2-4-6-17/h2-6,13-15,20-21,23,25,28-29H,7-12,16H2,1H3/b27-15+/t20-,21+,23-,25-,26-/m0/s1 |
| InChIKey | BBNKDUMCNLNBCM-CONRIDAPSA-N |
| XLogP | 5.16 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|