C31H47NO3 — CID 142966204
ethane;2-[(E)-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]iminomethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 142966204) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is ethane;2-[(E)-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]iminomethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | ethane;2-[(E)-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]iminomethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 142966204 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | ethane;2-[(E)-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]iminomethyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=C/C(=C\C=C/C)CO/N=C/c1cc2c(cc1O)CCC1C2CCC2(C)C(O)CCC12.CC.CC |
| InChI | InChI=1S/C27H35NO3.2C2H6/c1-4-6-7-18(5-2)17-31-28-16-20-14-23-19(15-25(20)29)8-9-22-21(23)12-13-27(3)24(22)10-11-26(27)30;2*1-2/h4-7,14-16,21-22,24,26,29-30H,2,8-13,17H2,1,3H3;2*1-2H3/b6-4-,18-7+,28-16+;; |
| InChIKey | NVGZIRZNMHKGBO-CDPXYRPHSA-N |
| XLogP | 7.70 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|