C10H12O3 — CID 140519943
2-(2,2,3-trimethyl-5-oxocyclopent-3-en-1-ylidene)acetic acid (PubChem CID 140519943) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(2,2,3-trimethyl-5-oxocyclopent-3-en-1-ylidene)acetic acid.
| Compound Name | 2-(2,2,3-trimethyl-5-oxocyclopent-3-en-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 140519943 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(2,2,3-trimethyl-5-oxocyclopent-3-en-1-ylidene)acetic acid |
| SMILES | CC1=CC(=O)C(=CC(=O)O)C1(C)C |
| InChI | InChI=1S/C10H12O3/c1-6-4-8(11)7(5-9(12)13)10(6,2)3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | RCFVGKBBWLRGSG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|