C20H19F5N4O4 — CID 140522046
[(3R)-3-amino-1-[(2S)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4-difluoropyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate (PubChem CID 140522046) has the molecular formula C20H19F5N4O4 and a molecular weight of 474.39 g/mol. Its IUPAC name is [(3R)-3-amino-1-[(2S)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4-difluoropyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate.
| Compound Name | [(3R)-3-amino-1-[(2S)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4-difluoropyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate |
|---|---|
| PubChem CID | 140522046 |
| Molecular Formula | C20H19F5N4O4 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [(3R)-3-amino-1-[(2S)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4-difluoropyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C(OC=O)C(=O)N1CC(F)(F)C[C@H]1c1nc(C2CC2)no1 |
| InChI | InChI=1S/C20H19F5N4O4/c21-11-5-13(23)12(22)3-10(11)4-14(26)16(32-8-30)19(31)29-7-20(24,25)6-15(29)18-27-17(28-33-18)9-1-2-9/h3,5,8-9,14-16H,1-2,4,6-7,26H2/t14-,15+,16?/m1/s1 |
| InChIKey | IWJJDFVCDYAGAX-YSPPHNQVSA-N |
| XLogP | 2.38 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|