C15H18N4O — CID 140524659
N-(pyridin-2-ylmethyl)-1,2,3,3a,4,5-hexahydrocyclohepta[c]pyrazole-3-carboxamide (PubChem CID 140524659) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1,2,3,3a,4,5-hexahydrocyclohepta[c]pyrazole-3-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-1,2,3,3a,4,5-hexahydrocyclohepta[c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 140524659 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1,2,3,3a,4,5-hexahydrocyclohepta[c]pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1NNC2=CC=CCCC21 |
| InChI | InChI=1S/C15H18N4O/c20-15(17-10-11-6-4-5-9-16-11)14-12-7-2-1-3-8-13(12)18-19-14/h1,3-6,8-9,12,14,18-19H,2,7,10H2,(H,17,20) |
| InChIKey | OLUNSFSFJGWTFD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |