C23H39NO5 — CID 140524745
ethyl 3-[4-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)ethoxy]cyclohexyl]-2-ethoxyprop-2-enoate (PubChem CID 140524745) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is ethyl 3-[4-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)ethoxy]cyclohexyl]-2-ethoxyprop-2-enoate.
| Compound Name | ethyl 3-[4-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)ethoxy]cyclohexyl]-2-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 140524745 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | ethyl 3-[4-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)ethoxy]cyclohexyl]-2-ethoxyprop-2-enoate |
| SMILES | CCOC(=O)C(=CC1CCC(OCCN2CCOC3CCCCC32)CC1)OCC |
| InChI | InChI=1S/C23H39NO5/c1-3-26-22(23(25)27-4-2)17-18-9-11-19(12-10-18)28-15-13-24-14-16-29-21-8-6-5-7-20(21)24/h17-21H,3-16H2,1-2H3 |
| InChIKey | UCNNACXANLUBHM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|