C32H32O9 — CID 140529579
[2-(3-hydroxy-4-methoxyphenyl)-4,5,6-trimethoxy-3H-inden-1-yl]-(4,5,6-trimethoxy-3H-inden-1-yl)methanone (PubChem CID 140529579) has the molecular formula C32H32O9 and a molecular weight of 560.60 g/mol. Its IUPAC name is [2-(3-hydroxy-4-methoxyphenyl)-4,5,6-trimethoxy-3H-inden-1-yl]-(4,5,6-trimethoxy-3H-inden-1-yl)methanone.
| Compound Name | [2-(3-hydroxy-4-methoxyphenyl)-4,5,6-trimethoxy-3H-inden-1-yl]-(4,5,6-trimethoxy-3H-inden-1-yl)methanone |
|---|---|
| PubChem CID | 140529579 |
| Molecular Formula | C32H32O9 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | [2-(3-hydroxy-4-methoxyphenyl)-4,5,6-trimethoxy-3H-inden-1-yl]-(4,5,6-trimethoxy-3H-inden-1-yl)methanone |
| SMILES | COc1ccc(C2=C(C(=O)C3=CCc4c3cc(OC)c(OC)c4OC)c3cc(OC)c(OC)c(OC)c3C2)cc1O |
| InChI | InChI=1S/C32H32O9/c1-35-24-11-8-16(12-23(24)33)19-13-22-21(15-26(37-3)32(41-7)30(22)39-5)27(19)28(34)17-9-10-18-20(17)14-25(36-2)31(40-6)29(18)38-4/h8-9,11-12,14-15,33H,10,13H2,1-7H3 |
| InChIKey | RWINTWZIUANQKB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|