C21H21O5W- — CID 140663662
2,3,4-trimethoxy-9-(4-methoxybenzene-5-id-1-yl)-5,7-dihydrobenzo[7]annulen-6-one;tungsten (PubChem CID 140663662) has the molecular formula C21H21O5W- and a molecular weight of 537.23 g/mol. Its IUPAC name is 2,3,4-trimethoxy-9-(4-methoxybenzene-5-id-1-yl)-5,7-dihydrobenzo[7]annulen-6-one;tungsten.
| Compound Name | 2,3,4-trimethoxy-9-(4-methoxybenzene-5-id-1-yl)-5,7-dihydrobenzo[7]annulen-6-one;tungsten |
|---|---|
| PubChem CID | 140663662 |
| Molecular Formula | C21H21O5W- |
| Molecular Weight | 537.23 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 2,3,4-trimethoxy-9-(4-methoxybenzene-5-id-1-yl)-5,7-dihydrobenzo[7]annulen-6-one;tungsten |
| SMILES | COc1[c-]cc(C2=CCC(=O)Cc3c2cc(OC)c(OC)c3OC)cc1.[W] |
| InChI | InChI=1S/C21H21O5.W/c1-23-15-8-5-13(6-9-15)16-10-7-14(22)11-18-17(16)12-19(24-2)21(26-4)20(18)25-3;/h5-6,8,10,12H,7,11H2,1-4H3;/q-1; |
| InChIKey | FTIFPQIDCFKRIX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|