C15H12Cl2O2 — CID 174911253
2,7-dichloro-1,3-dimethoxy-9H-fluorene (PubChem CID 174911253) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2,7-dichloro-1,3-dimethoxy-9H-fluorene.
| Compound Name | 2,7-dichloro-1,3-dimethoxy-9H-fluorene |
|---|---|
| PubChem CID | 174911253 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2,7-dichloro-1,3-dimethoxy-9H-fluorene |
| SMILES | COc1cc2c(c(OC)c1Cl)Cc1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C15H12Cl2O2/c1-18-13-7-11-10-4-3-9(16)5-8(10)6-12(11)15(19-2)14(13)17/h3-5,7H,6H2,1-2H3 |
| InChIKey | CXEYOIMLSMUCAH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |