About 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate
2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate (PubChem CID 140533356) has the molecular formula C13H25N3O3
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate |
| PubChem CID | 140533356 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCN1CC2CNCC(C1)O2 |
| InChI | InChI=1S/C13H25N3O3/c1-13(2,3)15-12(17)18-5-4-16-8-10-6-14-7-11(9-16)19-10/h10-11,14H,4-9H2,1-3H3,(H,15,17) |
| InChIKey | XJHTZEINBQKACZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate?
The IUPAC name of 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate (CID 140533356) is 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate.
What is the SMILES notation for 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate?
The canonical SMILES for 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCCN1CC2CNCC(C1)O2.
What is the InChIKey of 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate?
The InChIKey is XJHTZEINBQKACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O3/c1-13(2,3)15-12(17)18-5-4-16-8-10-6-14-7-11(9-16)19-10/h10-11,14H,4-9H2,1-3H3,(H,15,17).
What are the key properties of 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate?
2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate has a molecular weight of 271.36 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)ethyl N-tert-butylcarbamate is sourced from PubChem (CID 140533356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).