C42H32N6O2 — CID 140534147
1-cyclohexyl-2-(2,3-diphenylquinoxalin-6-yl)-4-quinoxalin-6-ylbenzimidazole-5-carboxylic acid (PubChem CID 140534147) has the molecular formula C42H32N6O2 and a molecular weight of 652.76 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,3-diphenylquinoxalin-6-yl)-4-quinoxalin-6-ylbenzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-(2,3-diphenylquinoxalin-6-yl)-4-quinoxalin-6-ylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 140534147 |
| Molecular Formula | C42H32N6O2 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 1-cyclohexyl-2-(2,3-diphenylquinoxalin-6-yl)-4-quinoxalin-6-ylbenzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(nc(-c3ccc4nc(-c5ccccc5)c(-c5ccccc5)nc4c3)n2C2CCCCC2)c1-c1ccc2nccnc2c1 |
| InChI | InChI=1S/C42H32N6O2/c49-42(50)31-18-21-36-40(37(31)28-16-19-32-34(24-28)44-23-22-43-32)47-41(48(36)30-14-8-3-9-15-30)29-17-20-33-35(25-29)46-39(27-12-6-2-7-13-27)38(45-33)26-10-4-1-5-11-26/h1-2,4-7,10-13,16-25,30H,3,8-9,14-15H2,(H,49,50) |
| InChIKey | WZTZIGZGQPKHIS-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |