C18H28O5 — CID 140534504
butan-2-yl 3-[4-(2-prop-2-enoyloxyethoxy)cyclohexyl]prop-2-enoate (PubChem CID 140534504) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is butan-2-yl 3-[4-(2-prop-2-enoyloxyethoxy)cyclohexyl]prop-2-enoate.
| Compound Name | butan-2-yl 3-[4-(2-prop-2-enoyloxyethoxy)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 140534504 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | butan-2-yl 3-[4-(2-prop-2-enoyloxyethoxy)cyclohexyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCOC1CCC(C=CC(=O)OC(C)CC)CC1 |
| InChI | InChI=1S/C18H28O5/c1-4-14(3)23-18(20)11-8-15-6-9-16(10-7-15)21-12-13-22-17(19)5-2/h5,8,11,14-16H,2,4,6-7,9-10,12-13H2,1,3H3 |
| InChIKey | HNOCNCQUTNQYEZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|