C23H26O6 — CID 140536627
3-[5-(4-hydroxy-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl)penta-2,4-dienylidene]-4a,5,6,7,8,8a-hexahydrochromene-2,4-dione (PubChem CID 140536627) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[5-(4-hydroxy-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl)penta-2,4-dienylidene]-4a,5,6,7,8,8a-hexahydrochromene-2,4-dione.
| Compound Name | 3-[5-(4-hydroxy-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl)penta-2,4-dienylidene]-4a,5,6,7,8,8a-hexahydrochromene-2,4-dione |
|---|---|
| PubChem CID | 140536627 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[5-(4-hydroxy-2-oxo-4a,5,6,7,8,8a-hexahydrochromen-3-yl)penta-2,4-dienylidene]-4a,5,6,7,8,8a-hexahydrochromene-2,4-dione |
| SMILES | O=C1OC2CCCCC2C(=O)C1=CC=CC=CC1=C(O)C2CCCCC2OC1=O |
| InChI | InChI=1S/C23H26O6/c24-20-14-8-4-6-12-18(14)28-22(26)16(20)10-2-1-3-11-17-21(25)15-9-5-7-13-19(15)29-23(17)27/h1-3,10-11,14-15,18-19,24H,4-9,12-13H2 |
| InChIKey | VKMDCXRVUCIWMY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|