C13H16N4O2 — CID 140536966
3-methyl-5-propan-2-yl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione (PubChem CID 140536966) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione.
| Compound Name | 3-methyl-5-propan-2-yl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione |
|---|---|
| PubChem CID | 140536966 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-methyl-5-propan-2-yl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione |
| SMILES | Cc1nn(C(C)C)c(=O)c2cc3n(c12)CCNC3=O |
| InChI | InChI=1S/C13H16N4O2/c1-7(2)17-13(19)9-6-10-12(18)14-4-5-16(10)11(9)8(3)15-17/h6-7H,4-5H2,1-3H3,(H,14,18) |
| InChIKey | WFMUFCDDWCOZDR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |