C10H10N4O2 — CID 91365303
3-methyl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione (PubChem CID 91365303) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-methyl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione.
| Compound Name | 3-methyl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione |
|---|---|
| PubChem CID | 91365303 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-methyl-1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,8-triene-6,10-dione |
| SMILES | Cc1n[nH]c(=O)c2cc3n(c12)CCNC3=O |
| InChI | InChI=1S/C10H10N4O2/c1-5-8-6(9(15)13-12-5)4-7-10(16)11-2-3-14(7)8/h4H,2-3H2,1H3,(H,11,16)(H,13,15) |
| InChIKey | VDEKAPFRIBWZNG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |