About 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one
8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 130281358) has the molecular formula C15H17FN2O
and a molecular weight of 260.31 g/mol. Its IUPAC name is 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
Molecular Properties
| Compound Name | 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| PubChem CID | 130281358 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | CCCc1cc(F)cc2c(C)c3n(c12)CCNC3=O |
| InChI | InChI=1S/C15H17FN2O/c1-3-4-10-7-11(16)8-12-9(2)13-15(19)17-5-6-18(13)14(10)12/h7-8H,3-6H2,1-2H3,(H,17,19) |
| InChIKey | QOVPCBBSURWCDW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The IUPAC name of 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (CID 130281358) is 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
What is the SMILES notation for 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The canonical SMILES for 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is CCCc1cc(F)cc2c(C)c3n(c12)CCNC3=O.
What is the InChIKey of 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The InChIKey is QOVPCBBSURWCDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O/c1-3-4-10-7-11(16)8-12-9(2)13-15(19)17-5-6-18(13)14(10)12/h7-8H,3-6H2,1-2H3,(H,17,19).
What are the key properties of 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one has a molecular weight of 260.31 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-10-methyl-6-propyl-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is sourced from PubChem (CID 130281358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).