C20H27F3NO7P — CID 140537098
2-amino-2-[(E)-2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethenyl]-1-(1-oxo-2,4-dioxa-1λ5-phosphabicyclo[1.1.0]butan-3-yl)propane-1,1,3-triol (PubChem CID 140537098) has the molecular formula C20H27F3NO7P and a molecular weight of 481.40 g/mol. Its IUPAC name is 2-amino-2-[(E)-2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethenyl]-1-(1-oxo-2,4-dioxa-1λ5-phosphabicyclo[1.1.0]butan-3-yl)propane-1,1,3-triol.
| Compound Name | 2-amino-2-[(E)-2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethenyl]-1-(1-oxo-2,4-dioxa-1λ5-phosphabicyclo[1.1.0]butan-3-yl)propane-1,1,3-triol |
|---|---|
| PubChem CID | 140537098 |
| Molecular Formula | C20H27F3NO7P |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-amino-2-[(E)-2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethenyl]-1-(1-oxo-2,4-dioxa-1λ5-phosphabicyclo[1.1.0]butan-3-yl)propane-1,1,3-triol |
| SMILES | CCCCCCCOc1ccc(/C=C/C(N)(CO)C(O)(O)C23OP2(=O)O3)cc1C(F)(F)F |
| InChI | InChI=1S/C20H27F3NO7P/c1-2-3-4-5-6-11-29-16-8-7-14(12-15(16)18(21,22)23)9-10-17(24,13-25)19(26,27)20-30-32(20,28)31-20/h7-10,12,25-27H,2-6,11,13,24H2,1H3/b10-9+ |
| InChIKey | IZGNQNOVEUXXKC-MDZDMXLPSA-N |
| XLogP | 3.35 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|