C20H30F3NO3 — CID 143486195
(E)-2-amino-4-[4-heptoxy-3-(trifluoromethyl)phenyl]-2-(methoxymethyl)but-3-en-1-ol (PubChem CID 143486195) has the molecular formula C20H30F3NO3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (E)-2-amino-4-[4-heptoxy-3-(trifluoromethyl)phenyl]-2-(methoxymethyl)but-3-en-1-ol.
| Compound Name | (E)-2-amino-4-[4-heptoxy-3-(trifluoromethyl)phenyl]-2-(methoxymethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 143486195 |
| Molecular Formula | C20H30F3NO3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (E)-2-amino-4-[4-heptoxy-3-(trifluoromethyl)phenyl]-2-(methoxymethyl)but-3-en-1-ol |
| SMILES | CCCCCCCOc1ccc(/C=C/C(N)(CO)COC)cc1C(F)(F)F |
| InChI | InChI=1S/C20H30F3NO3/c1-3-4-5-6-7-12-27-18-9-8-16(13-17(18)20(21,22)23)10-11-19(24,14-25)15-26-2/h8-11,13,25H,3-7,12,14-15,24H2,1-2H3/b11-10+ |
| InChIKey | UGGSAGLYHNACMO-ZHACJKMWSA-N |
| XLogP | 4.40 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|