C6H2O20P4 — CID 140538761
[(1R,2R,3R,8S,9R,15S)-2,3-dihydroxy-5,12,17-trioxo-4,6,7,10,11,13,14,16,18,19,20,21,22-tridecaoxa-5λ5,12λ5,17λ5-triphosphaheptacyclo[10.6.2.12,17.15,8.01,15.03,8.09,15]docosan-9-yl]-oxido-oxophosphanium (PubChem CID 140538761) has the molecular formula C6H2O20P4 and a molecular weight of 517.96 g/mol. Its IUPAC name is [(1R,2R,3R,8S,9R,15S)-2,3-dihydroxy-5,12,17-trioxo-4,6,7,10,11,13,14,16,18,19,20,21,22-tridecaoxa-5λ5,12λ5,17λ5-triphosphaheptacyclo[10.6.2.12,17.15,8.01,15.03,8.09,15]docosan-9-yl]-oxido-oxophosphanium.
| Compound Name | [(1R,2R,3R,8S,9R,15S)-2,3-dihydroxy-5,12,17-trioxo-4,6,7,10,11,13,14,16,18,19,20,21,22-tridecaoxa-5λ5,12λ5,17λ5-triphosphaheptacyclo[10.6.2.12,17.15,8.01,15.03,8.09,15]docosan-9-yl]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 140538761 |
| Molecular Formula | C6H2O20P4 |
| Molecular Weight | 517.96 g/mol |
| Exact Mass | 517.81 |
| IUPAC Name | [(1R,2R,3R,8S,9R,15S)-2,3-dihydroxy-5,12,17-trioxo-4,6,7,10,11,13,14,16,18,19,20,21,22-tridecaoxa-5λ5,12λ5,17λ5-triphosphaheptacyclo[10.6.2.12,17.15,8.01,15.03,8.09,15]docosan-9-yl]-oxido-oxophosphanium |
| SMILES | O=[P+]([O-])[C@]12OOP3(=O)OO[C@@]45OP(=O)(O[C@]4(O)[C@@]4(O)OP6(=O)OO[C@]41O6)O[C@@]52OO3 |
| InChI | InChI=1S/C6H2O20P4/c7-1-2(8)4(15-23-29(12,19-2)21-4)6(27(9)10)5-3(1,20-28(11,18-1)22-5)14-24-30(13,25-16-5)26-17-6/h7-8H/t1-,2-,3-,4+,5+,6-,28?,29?,30?/m1/s1 |
| InChIKey | CHPAVGYRDGHRAH-QFEIBDOYSA-N |
| XLogP | -1.45 |
| TPSA | 251.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.96 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|