About dioxirane-3,3-diol;zinc
dioxirane-3,3-diol;zinc (PubChem CID 87186873) has the molecular formula CH2O4Zn2
and a molecular weight of 208.80 g/mol. Its IUPAC name is dioxirane-3,3-diol;zinc.
Molecular Properties
| Compound Name | dioxirane-3,3-diol;zinc |
| PubChem CID | 87186873 |
| Molecular Formula | CH2O4Zn2 |
| Molecular Weight | 208.80 g/mol |
| Exact Mass | 205.85 |
| IUPAC Name | dioxirane-3,3-diol;zinc |
| SMILES | OC1(O)OO1.[Zn].[Zn] |
| InChI | InChI=1S/CH2O4.2Zn/c2-1(3)4-5-1;;/h2-3H;; |
| InChIKey | RCGMRNZKKJKRFH-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.80 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dioxirane-3,3-diol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxirane-3,3-diol;zinc?
The IUPAC name of dioxirane-3,3-diol;zinc (CID 87186873) is dioxirane-3,3-diol;zinc.
What is the SMILES notation for dioxirane-3,3-diol;zinc?
The canonical SMILES for dioxirane-3,3-diol;zinc is OC1(O)OO1.[Zn].[Zn].
What is the InChIKey of dioxirane-3,3-diol;zinc?
The InChIKey is RCGMRNZKKJKRFH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O4.2Zn/c2-1(3)4-5-1;;/h2-3H;;.
What are the key properties of dioxirane-3,3-diol;zinc?
dioxirane-3,3-diol;zinc has a molecular weight of 208.80 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxirane-3,3-diol;zinc is sourced from PubChem (CID 87186873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).