About cobalt;dioxirane-3,3-diol;manganese
cobalt;dioxirane-3,3-diol;manganese (PubChem CID 174678591) has the molecular formula CH2CoMn2O4
and a molecular weight of 246.83 g/mol. Its IUPAC name is cobalt;dioxirane-3,3-diol;manganese.
Molecular Properties
| Compound Name | cobalt;dioxirane-3,3-diol;manganese |
| PubChem CID | 174678591 |
| Molecular Formula | CH2CoMn2O4 |
| Molecular Weight | 246.83 g/mol |
| Exact Mass | 246.80 |
| IUPAC Name | cobalt;dioxirane-3,3-diol;manganese |
| SMILES | OC1(O)OO1.[Co].[Mn].[Mn] |
| InChI | InChI=1S/CH2O4.Co.2Mn/c2-1(3)4-5-1;;;/h2-3H;;; |
| InChIKey | NSBMZJJKSVALSO-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.83 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cobalt;dioxirane-3,3-diol;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;dioxirane-3,3-diol;manganese?
The IUPAC name of cobalt;dioxirane-3,3-diol;manganese (CID 174678591) is cobalt;dioxirane-3,3-diol;manganese.
What is the SMILES notation for cobalt;dioxirane-3,3-diol;manganese?
The canonical SMILES for cobalt;dioxirane-3,3-diol;manganese is OC1(O)OO1.[Co].[Mn].[Mn].
What is the InChIKey of cobalt;dioxirane-3,3-diol;manganese?
The InChIKey is NSBMZJJKSVALSO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O4.Co.2Mn/c2-1(3)4-5-1;;;/h2-3H;;;.
What are the key properties of cobalt;dioxirane-3,3-diol;manganese?
cobalt;dioxirane-3,3-diol;manganese has a molecular weight of 246.83 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;dioxirane-3,3-diol;manganese is sourced from PubChem (CID 174678591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).