About (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate
(4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate (PubChem CID 140539641) has the molecular formula C18H14N4O2S
and a molecular weight of 350.40 g/mol. Its IUPAC name is (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate.
Molecular Properties
| Compound Name | (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate |
| PubChem CID | 140539641 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate |
| SMILES | [H]/N=C(\NC(=O)c1ccccc1)Oc1ccc(Sc2ncccn2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c19-17(22-16(23)13-5-2-1-3-6-13)24-14-7-9-15(10-8-14)25-18-20-11-4-12-21-18/h1-12H,(H2,19,22,23) |
| InChIKey | LCCZGSFSONTDDH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate?
The IUPAC name of (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate (CID 140539641) is (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate.
What is the SMILES notation for (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate?
The canonical SMILES for (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate is [H]/N=C(\NC(=O)c1ccccc1)Oc1ccc(Sc2ncccn2)cc1.
What is the InChIKey of (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate?
The InChIKey is LCCZGSFSONTDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O2S/c19-17(22-16(23)13-5-2-1-3-6-13)24-14-7-9-15(10-8-14)25-18-20-11-4-12-21-18/h1-12H,(H2,19,22,23).
What are the key properties of (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate?
(4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate has a molecular weight of 350.40 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyrimidin-2-ylsulfanylphenyl) N-benzoylcarbamimidate is sourced from PubChem (CID 140539641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).