C20H35Cl2FN4 — CID 140544443
1-(3,4-dichlorocyclohexyl)-4-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]piperazine (PubChem CID 140544443) has the molecular formula C20H35Cl2FN4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-4-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]piperazine.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-4-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 140544443 |
| Molecular Formula | C20H35Cl2FN4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-4-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]piperazine |
| SMILES | FC1CCC(C2NNCC2CN2CCN(C3CCC(Cl)C(Cl)C3)CC2)CC1 |
| InChI | InChI=1S/C20H35Cl2FN4/c21-18-6-5-17(11-19(18)22)27-9-7-26(8-10-27)13-15-12-24-25-20(15)14-1-3-16(23)4-2-14/h14-20,24-25H,1-13H2 |
| InChIKey | JXUTZSWROBESHB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|