C21H39FN4 — CID 140544450
1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(4-methylcyclohexyl)piperazine (PubChem CID 140544450) has the molecular formula C21H39FN4 and a molecular weight of 366.57 g/mol. Its IUPAC name is 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(4-methylcyclohexyl)piperazine.
| Compound Name | 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(4-methylcyclohexyl)piperazine |
|---|---|
| PubChem CID | 140544450 |
| Molecular Formula | C21H39FN4 |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(4-methylcyclohexyl)piperazine |
| SMILES | CC1CCC(N2CCN(CC3CNNC3C3CCC(F)CC3)CC2)CC1 |
| InChI | InChI=1S/C21H39FN4/c1-16-2-8-20(9-3-16)26-12-10-25(11-13-26)15-18-14-23-24-21(18)17-4-6-19(22)7-5-17/h16-21,23-24H,2-15H2,1H3 |
| InChIKey | ZFALXIYZOGMQKJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |