C19H35FIN5 — CID 140544462
1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(5-iodopiperidin-2-yl)piperazine (PubChem CID 140544462) has the molecular formula C19H35FIN5 and a molecular weight of 479.43 g/mol. Its IUPAC name is 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(5-iodopiperidin-2-yl)piperazine.
| Compound Name | 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(5-iodopiperidin-2-yl)piperazine |
|---|---|
| PubChem CID | 140544462 |
| Molecular Formula | C19H35FIN5 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[[3-(4-fluorocyclohexyl)pyrazolidin-4-yl]methyl]-4-(5-iodopiperidin-2-yl)piperazine |
| SMILES | FC1CCC(C2NNCC2CN2CCN(C3CCC(I)CN3)CC2)CC1 |
| InChI | InChI=1S/C19H35FIN5/c20-16-3-1-14(2-4-16)19-15(11-23-24-19)13-25-7-9-26(10-8-25)18-6-5-17(21)12-22-18/h14-19,22-24H,1-13H2 |
| InChIKey | GVPXLDARDBBCRI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|