C16H28ClFN4O — CID 168818777
4-chloro-5-[4-[(4-fluoro-2-methylcyclohexyl)methyl]piperazin-1-yl]diazinan-3-one (PubChem CID 168818777) has the molecular formula C16H28ClFN4O and a molecular weight of 346.88 g/mol. Its IUPAC name is 4-chloro-5-[4-[(4-fluoro-2-methylcyclohexyl)methyl]piperazin-1-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[4-[(4-fluoro-2-methylcyclohexyl)methyl]piperazin-1-yl]diazinan-3-one |
|---|---|
| PubChem CID | 168818777 |
| Molecular Formula | C16H28ClFN4O |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-chloro-5-[4-[(4-fluoro-2-methylcyclohexyl)methyl]piperazin-1-yl]diazinan-3-one |
| SMILES | CC1CC(F)CCC1CN1CCN(C2CNNC(=O)C2Cl)CC1 |
| InChI | InChI=1S/C16H28ClFN4O/c1-11-8-13(18)3-2-12(11)10-21-4-6-22(7-5-21)14-9-19-20-16(23)15(14)17/h11-15,19H,2-10H2,1H3,(H,20,23) |
| InChIKey | XLYGOLOYFWFLJR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|