C10H16BrF3N4O — CID 168818821
4-bromo-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]diazinan-3-one (PubChem CID 168818821) has the molecular formula C10H16BrF3N4O and a molecular weight of 345.16 g/mol. Its IUPAC name is 4-bromo-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]diazinan-3-one.
| Compound Name | 4-bromo-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]diazinan-3-one |
|---|---|
| PubChem CID | 168818821 |
| Molecular Formula | C10H16BrF3N4O |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-bromo-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]diazinan-3-one |
| SMILES | O=C1NNCC(N2CCN(CC(F)(F)F)CC2)C1Br |
| InChI | InChI=1S/C10H16BrF3N4O/c11-8-7(5-15-16-9(8)19)18-3-1-17(2-4-18)6-10(12,13)14/h7-8,15H,1-6H2,(H,16,19) |
| InChIKey | KYEOQCITGZUUAP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|